C7H10N4 — CID 137021593
N-methyl-1,2,3,7-tetrahydropyrrolo[2,3-d]pyrimidin-4-imine (PubChem CID 137021593) has the molecular formula C7H10N4 and a molecular weight of 150.19 g/mol. Its IUPAC name is N-methyl-1,2,3,7-tetrahydropyrrolo[2,3-d]pyrimidin-4-imine.
| Compound Name | N-methyl-1,2,3,7-tetrahydropyrrolo[2,3-d]pyrimidin-4-imine |
|---|---|
| PubChem CID | 137021593 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.19 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | N-methyl-1,2,3,7-tetrahydropyrrolo[2,3-d]pyrimidin-4-imine |
| SMILES | C/N=C1\NCNc2[nH]ccc21 |
| InChI | InChI=1S/C7H10N4/c1-8-6-5-2-3-9-7(5)11-4-10-6/h2-3,9,11H,4H2,1H3,(H,8,10) |
| InChIKey | PGGPXQLKERCAIA-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.19 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|