C7H13N5 — CID 137245181
4-N-ethenyl-6-methylimino-2,3-dihydro-1H-pyrimidine-4,5-diamine (PubChem CID 137245181) has the molecular formula C7H13N5 and a molecular weight of 167.22 g/mol. Its IUPAC name is 4-N-ethenyl-6-methylimino-2,3-dihydro-1H-pyrimidine-4,5-diamine.
| Compound Name | 4-N-ethenyl-6-methylimino-2,3-dihydro-1H-pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 137245181 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | 4-N-ethenyl-6-methylimino-2,3-dihydro-1H-pyrimidine-4,5-diamine |
| SMILES | C=CNC1=C(N)/C(=N/C)NCN1 |
| InChI | InChI=1S/C7H13N5/c1-3-10-7-5(8)6(9-2)11-4-12-7/h3,10,12H,1,4,8H2,2H3,(H,9,11) |
| InChIKey | ZFWPPAYHLTXIKR-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|