C6H9N3 — CID 136596177
N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine (PubChem CID 136596177) has the molecular formula C6H9N3 and a molecular weight of 123.16 g/mol. Its IUPAC name is N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine.
| Compound Name | N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine |
|---|---|
| PubChem CID | 136596177 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine |
| SMILES | C=C1NC=CN/C1=N\C |
| InChI | InChI=1S/C6H9N3/c1-5-6(7-2)9-4-3-8-5/h3-4,8H,1H2,2H3,(H,7,9) |
| InChIKey | VZJSPLSJERUBTF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|