About N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine
N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine (PubChem CID 136596177) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine.
Molecular Properties
| Compound Name | N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine |
| PubChem CID | 136596177 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine |
| SMILES | C=C1NC=CN/C1=N\C |
| InChI | InChI=1S/C6H9N3/c1-5-6(7-2)9-4-3-8-5/h3-4,8H,1H2,2H3,(H,7,9) |
| InChIKey | VZJSPLSJERUBTF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine?
The IUPAC name of N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine (CID 136596177) is N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine.
What is the SMILES notation for N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine?
The canonical SMILES for N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine is C=C1NC=CN/C1=N\C.
What is the InChIKey of N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine?
The InChIKey is VZJSPLSJERUBTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c1-5-6(7-2)9-4-3-8-5/h3-4,8H,1H2,2H3,(H,7,9).
What are the key properties of N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine?
N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine has a molecular weight of 123.16 g/mol, XLogP of 0.19, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-methylidene-1,4-dihydropyrazin-2-imine is sourced from PubChem (CID 136596177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).