C9H17N3 — CID 142067315
2-amino-N-ethenyl-N'-ethyl-3-methylbut-2-enimidamide (PubChem CID 142067315) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 2-amino-N-ethenyl-N'-ethyl-3-methylbut-2-enimidamide.
| Compound Name | 2-amino-N-ethenyl-N'-ethyl-3-methylbut-2-enimidamide |
|---|---|
| PubChem CID | 142067315 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 2-amino-N-ethenyl-N'-ethyl-3-methylbut-2-enimidamide |
| SMILES | C=CN/C(=N\CC)C(N)=C(C)C |
| InChI | InChI=1S/C9H17N3/c1-5-11-9(12-6-2)8(10)7(3)4/h5H,1,6,10H2,2-4H3,(H,11,12) |
| InChIKey | TWNGVZUUWXEFSA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|