About 2-amino-N'-ethenyl-3-methylbut-2-enimidamide;ethane;ethene
2-amino-N'-ethenyl-3-methylbut-2-enimidamide;ethane;ethene (PubChem CID 142067318) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is 2-amino-N'-ethenyl-3-methylbut-2-enimidamide;ethane;ethene.
Molecular Properties
| Compound Name | 2-amino-N'-ethenyl-3-methylbut-2-enimidamide;ethane;ethene |
| PubChem CID | 142067318 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 2-amino-N'-ethenyl-3-methylbut-2-enimidamide;ethane;ethene |
| SMILES | C=C.C=C/N=C(\N)C(N)=C(C)C.CC |
| InChI | InChI=1S/C7H13N3.C2H6.C2H4/c1-4-10-7(9)6(8)5(2)3;2*1-2/h4H,1,8H2,2-3H3,(H2,9,10);1-2H3;1-2H2 |
| InChIKey | SQPQJYDNCGFJHW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N'-ethenyl-3-methylbut-2-enimidamide;ethane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N'-ethenyl-3-methylbut-2-enimidamide;ethane;ethene?
The IUPAC name of 2-amino-N'-ethenyl-3-methylbut-2-enimidamide;ethane;ethene (CID 142067318) is 2-amino-N'-ethenyl-3-methylbut-2-enimidamide;ethane;ethene.
What is the SMILES notation for 2-amino-N'-ethenyl-3-methylbut-2-enimidamide;ethane;ethene?
The canonical SMILES for 2-amino-N'-ethenyl-3-methylbut-2-enimidamide;ethane;ethene is C=C.C=C/N=C(\N)C(N)=C(C)C.CC.
What is the InChIKey of 2-amino-N'-ethenyl-3-methylbut-2-enimidamide;ethane;ethene?
The InChIKey is SQPQJYDNCGFJHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3.C2H6.C2H4/c1-4-10-7(9)6(8)5(2)3;2*1-2/h4H,1,8H2,2-3H3,(H2,9,10);1-2H3;1-2H2.
What are the key properties of 2-amino-N'-ethenyl-3-methylbut-2-enimidamide;ethane;ethene?
2-amino-N'-ethenyl-3-methylbut-2-enimidamide;ethane;ethene has a molecular weight of 197.33 g/mol, XLogP of 2.57, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N'-ethenyl-3-methylbut-2-enimidamide;ethane;ethene is sourced from PubChem (CID 142067318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).