About ethane;ethenyl N-ethenylethanimidate
ethane;ethenyl N-ethenylethanimidate (PubChem CID 143602013) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is ethane;ethenyl N-ethenylethanimidate.
Molecular Properties
| Compound Name | ethane;ethenyl N-ethenylethanimidate |
| PubChem CID | 143602013 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | ethane;ethenyl N-ethenylethanimidate |
| SMILES | C=C/N=C(\C)OC=C.CC |
| InChI | InChI=1S/C6H9NO.C2H6/c1-4-7-6(3)8-5-2;1-2/h4-5H,1-2H2,3H3;1-2H3/b7-6+; |
| InChIKey | KHXNFTOECZEPFG-UHDJGPCESA-N |
| XLogP | 2.73 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethenyl N-ethenylethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethenyl N-ethenylethanimidate?
The IUPAC name of ethane;ethenyl N-ethenylethanimidate (CID 143602013) is ethane;ethenyl N-ethenylethanimidate.
What is the SMILES notation for ethane;ethenyl N-ethenylethanimidate?
The canonical SMILES for ethane;ethenyl N-ethenylethanimidate is C=C/N=C(\C)OC=C.CC.
What is the InChIKey of ethane;ethenyl N-ethenylethanimidate?
The InChIKey is KHXNFTOECZEPFG-UHDJGPCESA-N. The full InChI is InChI=1S/C6H9NO.C2H6/c1-4-7-6(3)8-5-2;1-2/h4-5H,1-2H2,3H3;1-2H3/b7-6+;.
What are the key properties of ethane;ethenyl N-ethenylethanimidate?
ethane;ethenyl N-ethenylethanimidate has a molecular weight of 141.21 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethenyl N-ethenylethanimidate is sourced from PubChem (CID 143602013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).