C9H15N3 — CID 126510332
(2E)-N-ethenyl-N'-methyl-2-(methylamino)penta-2,4-dienimidamide (PubChem CID 126510332) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is (2E)-N-ethenyl-N'-methyl-2-(methylamino)penta-2,4-dienimidamide.
| Compound Name | (2E)-N-ethenyl-N'-methyl-2-(methylamino)penta-2,4-dienimidamide |
|---|---|
| PubChem CID | 126510332 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | (2E)-N-ethenyl-N'-methyl-2-(methylamino)penta-2,4-dienimidamide |
| SMILES | C=C/C=C(NC)\C(=N\C)NC=C |
| InChI | InChI=1S/C9H15N3/c1-5-7-8(10-3)9(11-4)12-6-2/h5-7,10H,1-2H2,3-4H3,(H,11,12)/b8-7+ |
| InChIKey | ZJSUTDNJMXDOQX-BQYQJAHWSA-N |
| XLogP | 1.04 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|