About 4-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine
4-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine (PubChem CID 146822763) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 4-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine.
Analyze 4-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 4-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine (CID 146822763) is 4-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 4-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 4-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine is CC1=NCNc2[nH]ccc21.
What is the InChIKey of 4-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is ZWKFEPQBZXABAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c1-5-6-2-3-8-7(6)10-4-9-5/h2-3,8,10H,4H2,1H3.
What are the key properties of 4-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine?
4-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 135.17 g/mol, XLogP of 1.21, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,7-dihydro-1H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 146822763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).