About (4-methyl-1,2-dihydropyrrolo[2,3-d]pyrimidin-7-yl)phosphane
(4-methyl-1,2-dihydropyrrolo[2,3-d]pyrimidin-7-yl)phosphane (PubChem CID 137301368) has the molecular formula C7H10N3P
and a molecular weight of 167.15 g/mol. Its IUPAC name is (4-methyl-1,2-dihydropyrrolo[2,3-d]pyrimidin-7-yl)phosphane.
Molecular Properties
| Compound Name | (4-methyl-1,2-dihydropyrrolo[2,3-d]pyrimidin-7-yl)phosphane |
| PubChem CID | 137301368 |
| Molecular Formula | C7H10N3P |
| Molecular Weight | 167.15 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | (4-methyl-1,2-dihydropyrrolo[2,3-d]pyrimidin-7-yl)phosphane |
| SMILES | CC1=NCNc2c1ccn2P |
| InChI | InChI=1S/C7H10N3P/c1-5-6-2-3-10(11)7(6)9-4-8-5/h2-3,9H,4,11H2,1H3 |
| InChIKey | WXHYNRYIFHFMAC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-1,2-dihydropyrrolo[2,3-d]pyrimidin-7-yl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-1,2-dihydropyrrolo[2,3-d]pyrimidin-7-yl)phosphane?
The IUPAC name of (4-methyl-1,2-dihydropyrrolo[2,3-d]pyrimidin-7-yl)phosphane (CID 137301368) is (4-methyl-1,2-dihydropyrrolo[2,3-d]pyrimidin-7-yl)phosphane.
What is the SMILES notation for (4-methyl-1,2-dihydropyrrolo[2,3-d]pyrimidin-7-yl)phosphane?
The canonical SMILES for (4-methyl-1,2-dihydropyrrolo[2,3-d]pyrimidin-7-yl)phosphane is CC1=NCNc2c1ccn2P.
What is the InChIKey of (4-methyl-1,2-dihydropyrrolo[2,3-d]pyrimidin-7-yl)phosphane?
The InChIKey is WXHYNRYIFHFMAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N3P/c1-5-6-2-3-10(11)7(6)9-4-8-5/h2-3,9H,4,11H2,1H3.
What are the key properties of (4-methyl-1,2-dihydropyrrolo[2,3-d]pyrimidin-7-yl)phosphane?
(4-methyl-1,2-dihydropyrrolo[2,3-d]pyrimidin-7-yl)phosphane has a molecular weight of 167.15 g/mol, XLogP of 1.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1,2-dihydropyrrolo[2,3-d]pyrimidin-7-yl)phosphane is sourced from PubChem (CID 137301368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).