About 2,3-dimethyl-1H-pyrrole;pyridine
2,3-dimethyl-1H-pyrrole;pyridine (PubChem CID 174958879) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 2,3-dimethyl-1H-pyrrole;pyridine.
Molecular Properties
| Compound Name | 2,3-dimethyl-1H-pyrrole;pyridine |
| PubChem CID | 174958879 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2,3-dimethyl-1H-pyrrole;pyridine |
| SMILES | Cc1cc[nH]c1C.c1ccncc1 |
| InChI | InChI=1S/C6H9N.C5H5N/c1-5-3-4-7-6(5)2;1-2-4-6-5-3-1/h3-4,7H,1-2H3;1-5H |
| InChIKey | KXUBEMIKCIGXPI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethyl-1H-pyrrole;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1H-pyrrole;pyridine?
The IUPAC name of 2,3-dimethyl-1H-pyrrole;pyridine (CID 174958879) is 2,3-dimethyl-1H-pyrrole;pyridine.
What is the SMILES notation for 2,3-dimethyl-1H-pyrrole;pyridine?
The canonical SMILES for 2,3-dimethyl-1H-pyrrole;pyridine is Cc1cc[nH]c1C.c1ccncc1.
What is the InChIKey of 2,3-dimethyl-1H-pyrrole;pyridine?
The InChIKey is KXUBEMIKCIGXPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N.C5H5N/c1-5-3-4-7-6(5)2;1-2-4-6-5-3-1/h3-4,7H,1-2H3;1-5H.
What are the key properties of 2,3-dimethyl-1H-pyrrole;pyridine?
2,3-dimethyl-1H-pyrrole;pyridine has a molecular weight of 174.25 g/mol, XLogP of 2.71, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1H-pyrrole;pyridine is sourced from PubChem (CID 174958879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).