C8H8N4O — CID 154303266
N-imino-4,7-dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxamide (PubChem CID 154303266) has the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. Its IUPAC name is N-imino-4,7-dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxamide.
| Compound Name | N-imino-4,7-dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 154303266 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | N-imino-4,7-dihydro-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
| SMILES | [H]/N=N/C(=O)C1=CNc2[nH]ccc2C1 |
| InChI | InChI=1S/C8H8N4O/c9-12-8(13)6-3-5-1-2-10-7(5)11-4-6/h1-2,4,9-11H,3H2/b12-9+ |
| InChIKey | QCAYQPXLKRVVGP-FMIVXFBMSA-N |
| XLogP | 1.42 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|