C11H10N2O2 — CID 174868544
7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid (PubChem CID 174868544) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 174868544 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
| SMILES | C=Cc1ccc2c(n1)NC=C(C(=O)O)C2 |
| InChI | InChI=1S/C11H10N2O2/c1-2-9-4-3-7-5-8(11(14)15)6-12-10(7)13-9/h2-4,6H,1,5H2,(H,12,13)(H,14,15) |
| InChIKey | VMIXXJFDCBWLBQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |