7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid

C11H10N2O2 — CID 174868544

IUPAC7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid
SMILESC=Cc1ccc2c(n1)NC=C(C(=O)O)C2
InChIInChI=1S/C11H10N2O2/c1-2-9-4-3-7-5-8(11(14)15)6-12-10(7)13-9/h2-4,6H,1,5H2,(H,12,13)(H,14,15)
InChIKeyVMIXXJFDCBWLBQ-UHFFFAOYSA-N
MW202.21 g/mol
LogP1.66
Rot. Bonds2

About 7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid

7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid (PubChem CID 174868544) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid.

Molecular Properties

Compound Name7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid
PubChem CID174868544
Molecular FormulaC11H10N2O2
Molecular Weight202.21 g/mol
Exact Mass202.07
IUPAC Name7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid
SMILESC=Cc1ccc2c(n1)NC=C(C(=O)O)C2
InChIInChI=1S/C11H10N2O2/c1-2-9-4-3-7-5-8(11(14)15)6-12-10(7)13-9/h2-4,6H,1,5H2,(H,12,13)(H,14,15)
InChIKeyVMIXXJFDCBWLBQ-UHFFFAOYSA-N
XLogP1.66
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.21
LogP ≤ 51.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid?
The IUPAC name of 7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid (CID 174868544) is 7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid.
What is the SMILES notation for 7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid?
The canonical SMILES for 7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid is C=Cc1ccc2c(n1)NC=C(C(=O)O)C2.
What is the InChIKey of 7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid?
The InChIKey is VMIXXJFDCBWLBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c1-2-9-4-3-7-5-8(11(14)15)6-12-10(7)13-9/h2-4,6H,1,5H2,(H,12,13)(H,14,15).
What are the key properties of 7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid?
7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid has a molecular weight of 202.21 g/mol, XLogP of 1.66, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethenyl-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid is sourced from PubChem (CID 174868544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).