C20H22N2O2 — CID 165092403
2-ethenyl-7-ethynyl-8-(4-methoxy-4-methylpiperidin-1-yl)-5H-quinolin-6-one (PubChem CID 165092403) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-ethenyl-7-ethynyl-8-(4-methoxy-4-methylpiperidin-1-yl)-5H-quinolin-6-one.
| Compound Name | 2-ethenyl-7-ethynyl-8-(4-methoxy-4-methylpiperidin-1-yl)-5H-quinolin-6-one |
|---|---|
| PubChem CID | 165092403 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-ethenyl-7-ethynyl-8-(4-methoxy-4-methylpiperidin-1-yl)-5H-quinolin-6-one |
| SMILES | C#CC1=C(N2CCC(C)(OC)CC2)c2nc(C=C)ccc2CC1=O |
| InChI | InChI=1S/C20H22N2O2/c1-5-15-8-7-14-13-17(23)16(6-2)19(18(14)21-15)22-11-9-20(3,24-4)10-12-22/h2,5,7-8H,1,9-13H2,3-4H3 |
| InChIKey | HQUFXJIAKIUCPF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|