C19H19ClN2O — CID 165041622
8-(7-azaspiro[3.5]nonan-7-yl)-2-chloro-7-ethynyl-5H-quinolin-6-one (PubChem CID 165041622) has the molecular formula C19H19ClN2O and a molecular weight of 326.83 g/mol. Its IUPAC name is 8-(7-azaspiro[3.5]nonan-7-yl)-2-chloro-7-ethynyl-5H-quinolin-6-one.
| Compound Name | 8-(7-azaspiro[3.5]nonan-7-yl)-2-chloro-7-ethynyl-5H-quinolin-6-one |
|---|---|
| PubChem CID | 165041622 |
| Molecular Formula | C19H19ClN2O |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 8-(7-azaspiro[3.5]nonan-7-yl)-2-chloro-7-ethynyl-5H-quinolin-6-one |
| SMILES | C#CC1=C(N2CCC3(CCC3)CC2)c2nc(Cl)ccc2CC1=O |
| InChI | InChI=1S/C19H19ClN2O/c1-2-14-15(23)12-13-4-5-16(20)21-17(13)18(14)22-10-8-19(9-11-22)6-3-7-19/h1,4-5H,3,6-12H2 |
| InChIKey | DGBCZBLRNWXEAF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|