C20H23N3O — CID 158976114
5-(6-azaspiro[2.5]octan-6-yl)-3-(dimethylamino)-6-ethynyl-8H-isoquinolin-7-one (PubChem CID 158976114) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is 5-(6-azaspiro[2.5]octan-6-yl)-3-(dimethylamino)-6-ethynyl-8H-isoquinolin-7-one.
| Compound Name | 5-(6-azaspiro[2.5]octan-6-yl)-3-(dimethylamino)-6-ethynyl-8H-isoquinolin-7-one |
|---|---|
| PubChem CID | 158976114 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 5-(6-azaspiro[2.5]octan-6-yl)-3-(dimethylamino)-6-ethynyl-8H-isoquinolin-7-one |
| SMILES | C#CC1=C(N2CCC3(CC2)CC3)c2cc(N(C)C)ncc2CC1=O |
| InChI | InChI=1S/C20H23N3O/c1-4-15-17(24)11-14-13-21-18(22(2)3)12-16(14)19(15)23-9-7-20(5-6-20)8-10-23/h1,12-13H,5-11H2,2-3H3 |
| InChIKey | WCOHJUXTIOBSJY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|