C20H24N2O2 — CID 165083479
3-(1,1-dideuterioethyl)-6-ethynyl-5-(4-methoxy-4-methylpiperidin-1-yl)-8H-isoquinolin-7-one (PubChem CID 165083479) has the molecular formula C20H24N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-(1,1-dideuterioethyl)-6-ethynyl-5-(4-methoxy-4-methylpiperidin-1-yl)-8H-isoquinolin-7-one.
| Compound Name | 3-(1,1-dideuterioethyl)-6-ethynyl-5-(4-methoxy-4-methylpiperidin-1-yl)-8H-isoquinolin-7-one |
|---|---|
| PubChem CID | 165083479 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 3-(1,1-dideuterioethyl)-6-ethynyl-5-(4-methoxy-4-methylpiperidin-1-yl)-8H-isoquinolin-7-one |
| SMILES | [2H]C([2H])(C)c1cc2c(cn1)CC(=O)C(C#C)=C2N1CCC(C)(OC)CC1 |
| InChI | InChI=1S/C20H24N2O2/c1-5-15-12-17-14(13-21-15)11-18(23)16(6-2)19(17)22-9-7-20(3,24-4)8-10-22/h2,12-13H,5,7-11H2,1,3-4H3/i5D2 |
| InChIKey | PVAOSYNEMQNYQX-BFWBPSQCSA-N |
| XLogP | 2.61 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|