C21H25N3O — CID 158606730
5-(7-azaspiro[3.5]nonan-7-yl)-3-(dimethylamino)-6-ethynyl-8H-isoquinolin-7-one (PubChem CID 158606730) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 5-(7-azaspiro[3.5]nonan-7-yl)-3-(dimethylamino)-6-ethynyl-8H-isoquinolin-7-one.
| Compound Name | 5-(7-azaspiro[3.5]nonan-7-yl)-3-(dimethylamino)-6-ethynyl-8H-isoquinolin-7-one |
|---|---|
| PubChem CID | 158606730 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 5-(7-azaspiro[3.5]nonan-7-yl)-3-(dimethylamino)-6-ethynyl-8H-isoquinolin-7-one |
| SMILES | C#CC1=C(N2CCC3(CCC3)CC2)c2cc(N(C)C)ncc2CC1=O |
| InChI | InChI=1S/C21H25N3O/c1-4-16-18(25)12-15-14-22-19(23(2)3)13-17(15)20(16)24-10-8-21(9-11-24)6-5-7-21/h1,13-14H,5-12H2,2-3H3 |
| InChIKey | SCFBFOCHKFRRAP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|