C19H20N2O — CID 159759522
5-(2-azaspiro[3.5]nonan-2-yl)-6-ethynyl-8H-isoquinolin-7-one (PubChem CID 159759522) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 5-(2-azaspiro[3.5]nonan-2-yl)-6-ethynyl-8H-isoquinolin-7-one.
| Compound Name | 5-(2-azaspiro[3.5]nonan-2-yl)-6-ethynyl-8H-isoquinolin-7-one |
|---|---|
| PubChem CID | 159759522 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 5-(2-azaspiro[3.5]nonan-2-yl)-6-ethynyl-8H-isoquinolin-7-one |
| SMILES | C#CC1=C(N2CC3(CCCCC3)C2)c2ccncc2CC1=O |
| InChI | InChI=1S/C19H20N2O/c1-2-15-17(22)10-14-11-20-9-6-16(14)18(15)21-12-19(13-21)7-4-3-5-8-19/h1,6,9,11H,3-5,7-8,10,12-13H2 |
| InChIKey | NCDSVOGMKKDLMU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|