C21H24N2O2 — CID 165029171
8-(6-azaspiro[2.5]octan-6-yl)-7-ethynyl-2-(2-hydroxypropan-2-yl)-5H-quinolin-6-one (PubChem CID 165029171) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 8-(6-azaspiro[2.5]octan-6-yl)-7-ethynyl-2-(2-hydroxypropan-2-yl)-5H-quinolin-6-one.
| Compound Name | 8-(6-azaspiro[2.5]octan-6-yl)-7-ethynyl-2-(2-hydroxypropan-2-yl)-5H-quinolin-6-one |
|---|---|
| PubChem CID | 165029171 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 8-(6-azaspiro[2.5]octan-6-yl)-7-ethynyl-2-(2-hydroxypropan-2-yl)-5H-quinolin-6-one |
| SMILES | C#CC1=C(N2CCC3(CC2)CC3)c2nc(C(C)(C)O)ccc2CC1=O |
| InChI | InChI=1S/C21H24N2O2/c1-4-15-16(24)13-14-5-6-17(20(2,3)25)22-18(14)19(15)23-11-9-21(7-8-21)10-12-23/h1,5-6,25H,7-13H2,2-3H3 |
| InChIKey | RUIAZLJFWJQFMQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|