C21H26N2O4 — CID 163616428
7-(2-methoxyethoxy)-1-(4-methoxy-4-methylpiperidin-1-yl)-3-oxo-4H-naphthalene-2-carbonitrile (PubChem CID 163616428) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 7-(2-methoxyethoxy)-1-(4-methoxy-4-methylpiperidin-1-yl)-3-oxo-4H-naphthalene-2-carbonitrile.
| Compound Name | 7-(2-methoxyethoxy)-1-(4-methoxy-4-methylpiperidin-1-yl)-3-oxo-4H-naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 163616428 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 7-(2-methoxyethoxy)-1-(4-methoxy-4-methylpiperidin-1-yl)-3-oxo-4H-naphthalene-2-carbonitrile |
| SMILES | COCCOc1ccc2c(c1)C(N1CCC(C)(OC)CC1)=C(C#N)C(=O)C2 |
| InChI | InChI=1S/C21H26N2O4/c1-21(26-3)6-8-23(9-7-21)20-17-13-16(27-11-10-25-2)5-4-15(17)12-19(24)18(20)14-22/h4-5,13H,6-12H2,1-3H3 |
| InChIKey | HKKCIGMTPQHLNA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|