C14H16FN3O2 — CID 130380939
6-fluoro-7-piperazin-1-yl-1,4-dihydroquinoline-3-carboxylic acid (PubChem CID 130380939) has the molecular formula C14H16FN3O2 and a molecular weight of 277.30 g/mol. Its IUPAC name is 6-fluoro-7-piperazin-1-yl-1,4-dihydroquinoline-3-carboxylic acid.
| Compound Name | 6-fluoro-7-piperazin-1-yl-1,4-dihydroquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 130380939 |
| Molecular Formula | C14H16FN3O2 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 6-fluoro-7-piperazin-1-yl-1,4-dihydroquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1=CNc2cc(N3CCNCC3)c(F)cc2C1 |
| InChI | InChI=1S/C14H16FN3O2/c15-11-6-9-5-10(14(19)20)8-17-12(9)7-13(11)18-3-1-16-2-4-18/h6-8,16-17H,1-5H2,(H,19,20) |
| InChIKey | CKDUYOGMQXBFHZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|