C18H20FN3O2 — CID 143971701
1-cyclopropyl-7-fluoro-4-oxo-8-piperazin-1-yl-5H-1-benzazepine-3-carbaldehyde (PubChem CID 143971701) has the molecular formula C18H20FN3O2 and a molecular weight of 329.38 g/mol. Its IUPAC name is 1-cyclopropyl-7-fluoro-4-oxo-8-piperazin-1-yl-5H-1-benzazepine-3-carbaldehyde.
| Compound Name | 1-cyclopropyl-7-fluoro-4-oxo-8-piperazin-1-yl-5H-1-benzazepine-3-carbaldehyde |
|---|---|
| PubChem CID | 143971701 |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-cyclopropyl-7-fluoro-4-oxo-8-piperazin-1-yl-5H-1-benzazepine-3-carbaldehyde |
| SMILES | O=CC1=CN(C2CC2)c2cc(N3CCNCC3)c(F)cc2CC1=O |
| InChI | InChI=1S/C18H20FN3O2/c19-15-7-12-8-18(24)13(11-23)10-22(14-1-2-14)16(12)9-17(15)21-5-3-20-4-6-21/h7,9-11,14,20H,1-6,8H2 |
| InChIKey | ZSJLWDDDZSWJBU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|