C21H30FN3 — CID 142173444
1-cyclopropyl-6-fluoro-7-piperazin-1-yl-4-propan-2-ylidenequinoline;ethane (PubChem CID 142173444) has the molecular formula C21H30FN3 and a molecular weight of 343.49 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-7-piperazin-1-yl-4-propan-2-ylidenequinoline;ethane.
| Compound Name | 1-cyclopropyl-6-fluoro-7-piperazin-1-yl-4-propan-2-ylidenequinoline;ethane |
|---|---|
| PubChem CID | 142173444 |
| Molecular Formula | C21H30FN3 |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-7-piperazin-1-yl-4-propan-2-ylidenequinoline;ethane |
| SMILES | CC.CC(C)=C1C=CN(C2CC2)c2cc(N3CCNCC3)c(F)cc21 |
| InChI | InChI=1S/C19H24FN3.C2H6/c1-13(2)15-5-8-23(14-3-4-14)18-12-19(17(20)11-16(15)18)22-9-6-21-7-10-22;1-2/h5,8,11-12,14,21H,3-4,6-7,9-10H2,1-2H3;1-2H3 |
| InChIKey | LPJRKHYUQQGBSH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|