C20H17F2N3O4 — CID 171127167
6-fluoro-1-(4-fluorophenyl)-3,4-dioxo-7-piperazin-1-yl-2H-quinoline-2-carboxylic acid (PubChem CID 171127167) has the molecular formula C20H17F2N3O4 and a molecular weight of 401.37 g/mol. Its IUPAC name is 6-fluoro-1-(4-fluorophenyl)-3,4-dioxo-7-piperazin-1-yl-2H-quinoline-2-carboxylic acid.
| Compound Name | 6-fluoro-1-(4-fluorophenyl)-3,4-dioxo-7-piperazin-1-yl-2H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 171127167 |
| Molecular Formula | C20H17F2N3O4 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 6-fluoro-1-(4-fluorophenyl)-3,4-dioxo-7-piperazin-1-yl-2H-quinoline-2-carboxylic acid |
| SMILES | O=C1C(=O)C(C(=O)O)N(c2ccc(F)cc2)c2cc(N3CCNCC3)c(F)cc21 |
| InChI | InChI=1S/C20H17F2N3O4/c21-11-1-3-12(4-2-11)25-15-10-16(24-7-5-23-6-8-24)14(22)9-13(15)18(26)19(27)17(25)20(28)29/h1-4,9-10,17,23H,5-8H2,(H,28,29) |
| InChIKey | LJTUHROHUVFVIZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|