C17H18FN3O3 — CID 170925127
4-(aziridin-1-yl)-7-fluoro-1-oxo-6-piperazin-1-yl-4H-naphthalene-2-carboxylic acid (PubChem CID 170925127) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is 4-(aziridin-1-yl)-7-fluoro-1-oxo-6-piperazin-1-yl-4H-naphthalene-2-carboxylic acid.
| Compound Name | 4-(aziridin-1-yl)-7-fluoro-1-oxo-6-piperazin-1-yl-4H-naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 170925127 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 4-(aziridin-1-yl)-7-fluoro-1-oxo-6-piperazin-1-yl-4H-naphthalene-2-carboxylic acid |
| SMILES | O=C(O)C1=CC(N2CC2)c2cc(N3CCNCC3)c(F)cc2C1=O |
| InChI | InChI=1S/C17H18FN3O3/c18-13-7-11-10(8-15(13)20-3-1-19-2-4-20)14(21-5-6-21)9-12(16(11)22)17(23)24/h7-9,14,19H,1-6H2,(H,23,24) |
| InChIKey | PEBDRHXSVSKGEA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 72.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|