C13H9ClFNO3 — CID 59819453
4-(aziridin-1-yl)-6-chloro-7-fluoro-1-oxo-4H-naphthalene-2-carboxylic acid (PubChem CID 59819453) has the molecular formula C13H9ClFNO3 and a molecular weight of 281.67 g/mol. Its IUPAC name is 4-(aziridin-1-yl)-6-chloro-7-fluoro-1-oxo-4H-naphthalene-2-carboxylic acid.
| Compound Name | 4-(aziridin-1-yl)-6-chloro-7-fluoro-1-oxo-4H-naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 59819453 |
| Molecular Formula | C13H9ClFNO3 |
| Molecular Weight | 281.67 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 4-(aziridin-1-yl)-6-chloro-7-fluoro-1-oxo-4H-naphthalene-2-carboxylic acid |
| SMILES | O=C(O)C1=CC(N2CC2)c2cc(Cl)c(F)cc2C1=O |
| InChI | InChI=1S/C13H9ClFNO3/c14-9-3-6-7(4-10(9)15)12(17)8(13(18)19)5-11(6)16-1-2-16/h3-5,11H,1-2H2,(H,18,19) |
| InChIKey | VWEGWMIDTJIYJU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.67 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|