C14H14FN3O4 — CID 71440472
6-fluoro-2,4-dioxo-7-piperazin-1-yl-1H-quinoline-3-carboxylic acid (PubChem CID 71440472) has the molecular formula C14H14FN3O4 and a molecular weight of 307.28 g/mol. Its IUPAC name is 6-fluoro-2,4-dioxo-7-piperazin-1-yl-1H-quinoline-3-carboxylic acid.
| Compound Name | 6-fluoro-2,4-dioxo-7-piperazin-1-yl-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 71440472 |
| Molecular Formula | C14H14FN3O4 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 6-fluoro-2,4-dioxo-7-piperazin-1-yl-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)C1C(=O)Nc2cc(N3CCNCC3)c(F)cc2C1=O |
| InChI | InChI=1S/C14H14FN3O4/c15-8-5-7-9(6-10(8)18-3-1-16-2-4-18)17-13(20)11(12(7)19)14(21)22/h5-6,11,16H,1-4H2,(H,17,20)(H,21,22) |
| InChIKey | OHMIUCFMGSHJES-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|