C18H20FN3O5 — CID 67919807
7-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-6-fluoro-1-methoxy-3,4-dioxo-2H-quinoline-2-carboxylic acid (PubChem CID 67919807) has the molecular formula C18H20FN3O5 and a molecular weight of 377.37 g/mol. Its IUPAC name is 7-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-6-fluoro-1-methoxy-3,4-dioxo-2H-quinoline-2-carboxylic acid.
| Compound Name | 7-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-6-fluoro-1-methoxy-3,4-dioxo-2H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 67919807 |
| Molecular Formula | C18H20FN3O5 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 7-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-6-fluoro-1-methoxy-3,4-dioxo-2H-quinoline-2-carboxylic acid |
| SMILES | CON1c2cc(N3CCN4CCC3CC4)c(F)cc2C(=O)C(=O)C1C(=O)O |
| InChI | InChI=1S/C18H20FN3O5/c1-27-22-13-9-14(21-7-6-20-4-2-10(21)3-5-20)12(19)8-11(13)16(23)17(24)15(22)18(25)26/h8-10,15H,2-7H2,1H3,(H,25,26) |
| InChIKey | IOQAMNNLYLCFPI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|