C17H20FN3O6S — CID 45358938
1-cyclopropyl-6-fluoro-4-oxo-7-(4-sulfopiperazin-1-yl)-2,3-dihydroquinoline-3-carboxylic acid (PubChem CID 45358938) has the molecular formula C17H20FN3O6S and a molecular weight of 413.43 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-4-oxo-7-(4-sulfopiperazin-1-yl)-2,3-dihydroquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-4-oxo-7-(4-sulfopiperazin-1-yl)-2,3-dihydroquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 45358938 |
| Molecular Formula | C17H20FN3O6S |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-4-oxo-7-(4-sulfopiperazin-1-yl)-2,3-dihydroquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1CN(C2CC2)c2cc(N3CCN(S(=O)(=O)O)CC3)c(F)cc2C1=O |
| InChI | InChI=1S/C17H20FN3O6S/c18-13-7-11-14(21(10-1-2-10)9-12(16(11)22)17(23)24)8-15(13)19-3-5-20(6-4-19)28(25,26)27/h7-8,10,12H,1-6,9H2,(H,23,24)(H,25,26,27) |
| InChIKey | MCCFAFCYBGBMRA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|