C18H22FN3O3 — CID 150948832
1-cyclopropyl-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxo-2,3-dihydroquinoline-3-carboxylic acid (PubChem CID 150948832) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxo-2,3-dihydroquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxo-2,3-dihydroquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 150948832 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxo-2,3-dihydroquinoline-3-carboxylic acid |
| SMILES | CC1CN(c2cc3c(cc2F)C(=O)C(C(=O)O)CN3C2CC2)CCN1 |
| InChI | InChI=1S/C18H22FN3O3/c1-10-8-21(5-4-20-10)16-7-15-12(6-14(16)19)17(23)13(18(24)25)9-22(15)11-2-3-11/h6-7,10-11,13,20H,2-5,8-9H2,1H3,(H,24,25) |
| InChIKey | LJQPPMMHZQSUHH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|