C19H22FN3O5 — CID 170454424
5-cyclopropyl-8-fluoro-6-methoxy-7-(3-methylpiperazin-1-yl)-2-oxo-1,5-benzoxazepine-3-carboxylic acid (PubChem CID 170454424) has the molecular formula C19H22FN3O5 and a molecular weight of 391.40 g/mol. Its IUPAC name is 5-cyclopropyl-8-fluoro-6-methoxy-7-(3-methylpiperazin-1-yl)-2-oxo-1,5-benzoxazepine-3-carboxylic acid.
| Compound Name | 5-cyclopropyl-8-fluoro-6-methoxy-7-(3-methylpiperazin-1-yl)-2-oxo-1,5-benzoxazepine-3-carboxylic acid |
|---|---|
| PubChem CID | 170454424 |
| Molecular Formula | C19H22FN3O5 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 5-cyclopropyl-8-fluoro-6-methoxy-7-(3-methylpiperazin-1-yl)-2-oxo-1,5-benzoxazepine-3-carboxylic acid |
| SMILES | COc1c(N2CCNC(C)C2)c(F)cc2c1N(C1CC1)C=C(C(=O)O)C(=O)O2 |
| InChI | InChI=1S/C19H22FN3O5/c1-10-8-22(6-5-21-10)15-13(20)7-14-16(17(15)27-2)23(11-3-4-11)9-12(18(24)25)19(26)28-14/h7,9-11,21H,3-6,8H2,1-2H3,(H,24,25) |
| InChIKey | DJJMIGSODXWHDL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|