C18H20FN5O5 — CID 172920822
7-[(4Z)-3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-5-cyclopropyl-8-fluoro-2-oxopyrido[3,2-b][1,4]oxazepine-3-carboxylic acid (PubChem CID 172920822) has the molecular formula C18H20FN5O5 and a molecular weight of 405.39 g/mol. Its IUPAC name is 7-[(4Z)-3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-5-cyclopropyl-8-fluoro-2-oxopyrido[3,2-b][1,4]oxazepine-3-carboxylic acid.
| Compound Name | 7-[(4Z)-3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-5-cyclopropyl-8-fluoro-2-oxopyrido[3,2-b][1,4]oxazepine-3-carboxylic acid |
|---|---|
| PubChem CID | 172920822 |
| Molecular Formula | C18H20FN5O5 |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 7-[(4Z)-3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-5-cyclopropyl-8-fluoro-2-oxopyrido[3,2-b][1,4]oxazepine-3-carboxylic acid |
| SMILES | CO/N=C1\CN(c2nc3c(cc2F)OC(=O)C(C(=O)O)=CN3C2CC2)CC1CN |
| InChI | InChI=1S/C18H20FN5O5/c1-28-22-13-8-23(6-9(13)5-20)15-12(19)4-14-16(21-15)24(10-2-3-10)7-11(17(25)26)18(27)29-14/h4,7,9-10H,2-3,5-6,8,20H2,1H3,(H,25,26)/b22-13+ |
| InChIKey | ZKGXDUROIBIFLO-LPYMAVHISA-N |
| XLogP | 0.47 |
| TPSA | 130.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|