C19H22FN5O6S — CID 139836856
methylsulfonyl 7-[3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 139836856) has the molecular formula C19H22FN5O6S and a molecular weight of 467.48 g/mol. Its IUPAC name is methylsulfonyl 7-[3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | methylsulfonyl 7-[3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 139836856 |
| Molecular Formula | C19H22FN5O6S |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | methylsulfonyl 7-[3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CON=C1CN(c2nc3c(cc2F)c(=O)c(C(=O)OS(C)(=O)=O)cn3C2CC2)CC1CN |
| InChI | InChI=1S/C19H22FN5O6S/c1-30-23-15-9-24(7-10(15)6-21)18-14(20)5-12-16(26)13(19(27)31-32(2,28)29)8-25(11-3-4-11)17(12)22-18/h5,8,10-11H,3-4,6-7,9,21H2,1-2H3 |
| InChIKey | JKSJLCXIAFVTRF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 146.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|