C19H21FN4O4 — CID 123727501
7-[3-(aminomethyl)-4-methoxyiminocyclopentyl]-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 123727501) has the molecular formula C19H21FN4O4 and a molecular weight of 388.40 g/mol. Its IUPAC name is 7-[3-(aminomethyl)-4-methoxyiminocyclopentyl]-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 7-[3-(aminomethyl)-4-methoxyiminocyclopentyl]-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 123727501 |
| Molecular Formula | C19H21FN4O4 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 7-[3-(aminomethyl)-4-methoxyiminocyclopentyl]-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | CON=C1CC(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)CC1CN |
| InChI | InChI=1S/C19H21FN4O4/c1-28-23-15-5-9(4-10(15)7-21)16-14(20)6-12-17(25)13(19(26)27)8-24(11-2-3-11)18(12)22-16/h6,8-11H,2-5,7,21H2,1H3,(H,26,27) |
| InChIKey | PGSMFDFTGZSSCP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|