C30H28FN5O3 — CID 59699696
3-acetyl-1-cyclopropyl-6-fluoro-7-[(3Z)-3-methoxyimino-4-[(naphthalen-1-ylmethylideneamino)methyl]pyrrolidin-1-yl]-1,8-naphthyridin-4-one (PubChem CID 59699696) has the molecular formula C30H28FN5O3 and a molecular weight of 525.58 g/mol. Its IUPAC name is 3-acetyl-1-cyclopropyl-6-fluoro-7-[(3Z)-3-methoxyimino-4-[(naphthalen-1-ylmethylideneamino)methyl]pyrrolidin-1-yl]-1,8-naphthyridin-4-one.
| Compound Name | 3-acetyl-1-cyclopropyl-6-fluoro-7-[(3Z)-3-methoxyimino-4-[(naphthalen-1-ylmethylideneamino)methyl]pyrrolidin-1-yl]-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 59699696 |
| Molecular Formula | C30H28FN5O3 |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 3-acetyl-1-cyclopropyl-6-fluoro-7-[(3Z)-3-methoxyimino-4-[(naphthalen-1-ylmethylideneamino)methyl]pyrrolidin-1-yl]-1,8-naphthyridin-4-one |
| SMILES | CO/N=C1\CN(c2nc3c(cc2F)c(=O)c(C(C)=O)cn3C2CC2)CC1C/N=C/c1cccc2ccccc12 |
| InChI | InChI=1S/C30H28FN5O3/c1-18(37)25-16-36(22-10-11-22)29-24(28(25)38)12-26(31)30(33-29)35-15-21(27(17-35)34-39-2)14-32-13-20-8-5-7-19-6-3-4-9-23(19)20/h3-9,12-13,16,21-22H,10-11,14-15,17H2,1-2H3/b32-13+,34-27+ |
| InChIKey | IZXQHFIAIHPXRX-VSEPVWOUSA-N |
| XLogP | 4.78 |
| TPSA | 89.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|