C19H22FN5O8S — CID 87385222
[7-[(3R)-3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-3-carboxyoxy-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridin-2-yl]methanesulfonic acid (PubChem CID 87385222) has the molecular formula C19H22FN5O8S and a molecular weight of 499.48 g/mol. Its IUPAC name is [7-[(3R)-3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-3-carboxyoxy-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridin-2-yl]methanesulfonic acid.
| Compound Name | [7-[(3R)-3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-3-carboxyoxy-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridin-2-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 87385222 |
| Molecular Formula | C19H22FN5O8S |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | [7-[(3R)-3-(aminomethyl)-4-methoxyiminopyrrolidin-1-yl]-3-carboxyoxy-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridin-2-yl]methanesulfonic acid |
| SMILES | CON=C1CN(c2nc3c(cc2F)c(=O)c(OC(=O)O)c(CS(=O)(=O)O)n3C2CC2)C[C@H]1CN |
| InChI | InChI=1S/C19H22FN5O8S/c1-32-23-13-7-24(6-9(13)5-21)18-12(20)4-11-15(26)16(33-19(27)28)14(8-34(29,30)31)25(10-2-3-10)17(11)22-18/h4,9-10H,2-3,5-8,21H2,1H3,(H,27,28)(H,29,30,31)/t9-/m1/s1 |
| InChIKey | DLKJFIZZANBSQW-SECBINFHSA-N |
| XLogP | 0.71 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|