C22H24FN3O2 — CID 145237925
1-(1-cyclopropyl-4-ethenylidene-6-fluoro-8-methoxy-7-piperazin-1-ylquinolin-3-yl)propa-1,2-dien-1-ol (PubChem CID 145237925) has the molecular formula C22H24FN3O2 and a molecular weight of 381.45 g/mol. Its IUPAC name is 1-(1-cyclopropyl-4-ethenylidene-6-fluoro-8-methoxy-7-piperazin-1-ylquinolin-3-yl)propa-1,2-dien-1-ol.
| Compound Name | 1-(1-cyclopropyl-4-ethenylidene-6-fluoro-8-methoxy-7-piperazin-1-ylquinolin-3-yl)propa-1,2-dien-1-ol |
|---|---|
| PubChem CID | 145237925 |
| Molecular Formula | C22H24FN3O2 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-(1-cyclopropyl-4-ethenylidene-6-fluoro-8-methoxy-7-piperazin-1-ylquinolin-3-yl)propa-1,2-dien-1-ol |
| SMILES | C=C=C(O)C1=CN(C2CC2)c2c(cc(F)c(N3CCNCC3)c2OC)C1=C=C |
| InChI | InChI=1S/C22H24FN3O2/c1-4-15-16-12-18(23)21(25-10-8-24-9-11-25)22(28-3)20(16)26(14-6-7-14)13-17(15)19(27)5-2/h12-14,24,27H,1-2,6-11H2,3H3 |
| InChIKey | OUDXUZYPXMFOKE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|