C22H29FN4O2 — CID 142372765
N-[1-[7-[3-(aminomethyl)pyrrolidin-1-yl]-1-but-3-enyl-6-fluoro-8-methoxy-4-methylidenequinolin-3-yl]ethenyl]hydroxylamine (PubChem CID 142372765) has the molecular formula C22H29FN4O2 and a molecular weight of 400.50 g/mol. Its IUPAC name is N-[1-[7-[3-(aminomethyl)pyrrolidin-1-yl]-1-but-3-enyl-6-fluoro-8-methoxy-4-methylidenequinolin-3-yl]ethenyl]hydroxylamine.
| Compound Name | N-[1-[7-[3-(aminomethyl)pyrrolidin-1-yl]-1-but-3-enyl-6-fluoro-8-methoxy-4-methylidenequinolin-3-yl]ethenyl]hydroxylamine |
|---|---|
| PubChem CID | 142372765 |
| Molecular Formula | C22H29FN4O2 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N-[1-[7-[3-(aminomethyl)pyrrolidin-1-yl]-1-but-3-enyl-6-fluoro-8-methoxy-4-methylidenequinolin-3-yl]ethenyl]hydroxylamine |
| SMILES | C=CCCN1C=C(C(=C)NO)C(=C)c2cc(F)c(N3CCC(CN)C3)c(OC)c21 |
| InChI | InChI=1S/C22H29FN4O2/c1-5-6-8-26-13-18(15(3)25-28)14(2)17-10-19(23)21(22(29-4)20(17)26)27-9-7-16(11-24)12-27/h5,10,13,16,25,28H,1-3,6-9,11-12,24H2,4H3 |
| InChIKey | QPNIDXXETFSUAQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|