C19H26N4O2 — CID 134603920
N-[1-[7-[(3S)-3-(aminomethyl)pyrrolidin-1-yl]-8-methoxy-6-methyl-4-methylidene-1H-quinolin-3-yl]ethenyl]hydroxylamine (PubChem CID 134603920) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[1-[7-[(3S)-3-(aminomethyl)pyrrolidin-1-yl]-8-methoxy-6-methyl-4-methylidene-1H-quinolin-3-yl]ethenyl]hydroxylamine.
| Compound Name | N-[1-[7-[(3S)-3-(aminomethyl)pyrrolidin-1-yl]-8-methoxy-6-methyl-4-methylidene-1H-quinolin-3-yl]ethenyl]hydroxylamine |
|---|---|
| PubChem CID | 134603920 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-[1-[7-[(3S)-3-(aminomethyl)pyrrolidin-1-yl]-8-methoxy-6-methyl-4-methylidene-1H-quinolin-3-yl]ethenyl]hydroxylamine |
| SMILES | C=C(NO)C1=CNc2c(cc(C)c(N3CC[C@@H](CN)C3)c2OC)C1=C |
| InChI | InChI=1S/C19H26N4O2/c1-11-7-15-12(2)16(13(3)22-24)9-21-17(15)19(25-4)18(11)23-6-5-14(8-20)10-23/h7,9,14,21-22,24H,2-3,5-6,8,10,20H2,1,4H3/t14-/m0/s1 |
| InChIKey | IBTWOJZDPHWFIW-AWEZNQCLSA-N |
| XLogP | 2.60 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|