C12H14F2N2O2 — CID 63184853
4-[3-(aminomethyl)pyrrolidin-1-yl]-3,5-difluorobenzoic acid (PubChem CID 63184853) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is 4-[3-(aminomethyl)pyrrolidin-1-yl]-3,5-difluorobenzoic acid.
| Compound Name | 4-[3-(aminomethyl)pyrrolidin-1-yl]-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 63184853 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 4-[3-(aminomethyl)pyrrolidin-1-yl]-3,5-difluorobenzoic acid |
| SMILES | NCC1CCN(c2c(F)cc(C(=O)O)cc2F)C1 |
| InChI | InChI=1S/C12H14F2N2O2/c13-9-3-8(12(17)18)4-10(14)11(9)16-2-1-7(5-15)6-16/h3-4,7H,1-2,5-6,15H2,(H,17,18) |
| InChIKey | YJVMXWYSPOJYIZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |