C11H13Cl3N2 — CID 43126555
[1-(2,4,6-trichlorophenyl)pyrrolidin-3-yl]methanamine (PubChem CID 43126555) has the molecular formula C11H13Cl3N2 and a molecular weight of 279.60 g/mol. Its IUPAC name is [1-(2,4,6-trichlorophenyl)pyrrolidin-3-yl]methanamine.
| Compound Name | [1-(2,4,6-trichlorophenyl)pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 43126555 |
| Molecular Formula | C11H13Cl3N2 |
| Molecular Weight | 279.60 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | [1-(2,4,6-trichlorophenyl)pyrrolidin-3-yl]methanamine |
| SMILES | NCC1CCN(c2c(Cl)cc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C11H13Cl3N2/c12-8-3-9(13)11(10(14)4-8)16-2-1-7(5-15)6-16/h3-4,7H,1-2,5-6,15H2 |
| InChIKey | VLNYEQRAYCVWIP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |