C13H16F2N2O2 — CID 175880053
[(3R)-1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]methyl acetate (PubChem CID 175880053) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is [(3R)-1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]methyl acetate.
| Compound Name | [(3R)-1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]methyl acetate |
|---|---|
| PubChem CID | 175880053 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | [(3R)-1-(4-amino-2,6-difluorophenyl)pyrrolidin-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CCN(c2c(F)cc(N)cc2F)C1 |
| InChI | InChI=1S/C13H16F2N2O2/c1-8(18)19-7-9-2-3-17(6-9)13-11(14)4-10(16)5-12(13)15/h4-5,9H,2-3,6-7,16H2,1H3/t9-/m1/s1 |
| InChIKey | GVKTWCDXJDXQDV-SECBINFHSA-N |
| XLogP | 1.94 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|