C32H34FN3O2 — CID 134603907
[(3S)-1-[6-fluoro-8-methoxy-3-(1-methoxyethenyl)-4-methylidene-1-[(4-phenylphenyl)methyl]quinolin-7-yl]pyrrolidin-3-yl]methanamine (PubChem CID 134603907) has the molecular formula C32H34FN3O2 and a molecular weight of 511.64 g/mol. Its IUPAC name is [(3S)-1-[6-fluoro-8-methoxy-3-(1-methoxyethenyl)-4-methylidene-1-[(4-phenylphenyl)methyl]quinolin-7-yl]pyrrolidin-3-yl]methanamine.
| Compound Name | [(3S)-1-[6-fluoro-8-methoxy-3-(1-methoxyethenyl)-4-methylidene-1-[(4-phenylphenyl)methyl]quinolin-7-yl]pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 134603907 |
| Molecular Formula | C32H34FN3O2 |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | [(3S)-1-[6-fluoro-8-methoxy-3-(1-methoxyethenyl)-4-methylidene-1-[(4-phenylphenyl)methyl]quinolin-7-yl]pyrrolidin-3-yl]methanamine |
| SMILES | C=C(OC)C1=CN(Cc2ccc(-c3ccccc3)cc2)c2c(cc(F)c(N3CC[C@@H](CN)C3)c2OC)C1=C |
| InChI | InChI=1S/C32H34FN3O2/c1-21-27-16-29(33)31(35-15-14-24(17-34)19-35)32(38-4)30(27)36(20-28(21)22(2)37-3)18-23-10-12-26(13-11-23)25-8-6-5-7-9-25/h5-13,16,20,24H,1-2,14-15,17-19,34H2,3-4H3/t24-/m0/s1 |
| InChIKey | ZZBYMHLVLICAIN-DEOSSOPVSA-N |
| XLogP | 6.36 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|