C34H29F2N3 — CID 142372747
2-[7-(3-ethylpyrrolidin-1-yl)-6-fluoro-8-[3-[4-(4-fluorophenyl)phenyl]prop-1-ynyl]-4-methylidene-1H-quinolin-3-yl]prop-2-enenitrile (PubChem CID 142372747) has the molecular formula C34H29F2N3 and a molecular weight of 517.62 g/mol. Its IUPAC name is 2-[7-(3-ethylpyrrolidin-1-yl)-6-fluoro-8-[3-[4-(4-fluorophenyl)phenyl]prop-1-ynyl]-4-methylidene-1H-quinolin-3-yl]prop-2-enenitrile.
| Compound Name | 2-[7-(3-ethylpyrrolidin-1-yl)-6-fluoro-8-[3-[4-(4-fluorophenyl)phenyl]prop-1-ynyl]-4-methylidene-1H-quinolin-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 142372747 |
| Molecular Formula | C34H29F2N3 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 2-[7-(3-ethylpyrrolidin-1-yl)-6-fluoro-8-[3-[4-(4-fluorophenyl)phenyl]prop-1-ynyl]-4-methylidene-1H-quinolin-3-yl]prop-2-enenitrile |
| SMILES | C=C(C#N)C1=CNc2c(cc(F)c(N3CCC(CC)C3)c2C#CCc2ccc(-c3ccc(F)cc3)cc2)C1=C |
| InChI | InChI=1S/C34H29F2N3/c1-4-24-16-17-39(21-24)34-29(33-30(18-32(34)36)23(3)31(20-38-33)22(2)19-37)7-5-6-25-8-10-26(11-9-25)27-12-14-28(35)15-13-27/h8-15,18,20,24,38H,2-4,6,16-17,21H2,1H3 |
| InChIKey | YIYMGBBWYMMDIU-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|