C31H31FN2 — CID 142372752
3-ethenyl-7-(3-ethylpyrrolidin-1-yl)-6-fluoro-4-methylidene-1-[(4-phenylphenyl)methyl]quinoline (PubChem CID 142372752) has the molecular formula C31H31FN2 and a molecular weight of 450.60 g/mol. Its IUPAC name is 3-ethenyl-7-(3-ethylpyrrolidin-1-yl)-6-fluoro-4-methylidene-1-[(4-phenylphenyl)methyl]quinoline.
| Compound Name | 3-ethenyl-7-(3-ethylpyrrolidin-1-yl)-6-fluoro-4-methylidene-1-[(4-phenylphenyl)methyl]quinoline |
|---|---|
| PubChem CID | 142372752 |
| Molecular Formula | C31H31FN2 |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 3-ethenyl-7-(3-ethylpyrrolidin-1-yl)-6-fluoro-4-methylidene-1-[(4-phenylphenyl)methyl]quinoline |
| SMILES | C=CC1=CN(Cc2ccc(-c3ccccc3)cc2)c2cc(N3CCC(CC)C3)c(F)cc2C1=C |
| InChI | InChI=1S/C31H31FN2/c1-4-23-15-16-33(19-23)31-18-30-28(17-29(31)32)22(3)25(5-2)21-34(30)20-24-11-13-27(14-12-24)26-9-7-6-8-10-26/h5-14,17-18,21,23H,2-4,15-16,19-20H2,1H3 |
| InChIKey | WPYDPWGJJQYHRJ-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|