C31H32FN3O — CID 134603903
1-[6-fluoro-7-[3-(methylaminomethyl)pyrrolidin-1-yl]-4-methylidene-1-[(4-phenylphenyl)methyl]quinolin-3-yl]ethenol (PubChem CID 134603903) has the molecular formula C31H32FN3O and a molecular weight of 481.62 g/mol. Its IUPAC name is 1-[6-fluoro-7-[3-(methylaminomethyl)pyrrolidin-1-yl]-4-methylidene-1-[(4-phenylphenyl)methyl]quinolin-3-yl]ethenol.
| Compound Name | 1-[6-fluoro-7-[3-(methylaminomethyl)pyrrolidin-1-yl]-4-methylidene-1-[(4-phenylphenyl)methyl]quinolin-3-yl]ethenol |
|---|---|
| PubChem CID | 134603903 |
| Molecular Formula | C31H32FN3O |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 1-[6-fluoro-7-[3-(methylaminomethyl)pyrrolidin-1-yl]-4-methylidene-1-[(4-phenylphenyl)methyl]quinolin-3-yl]ethenol |
| SMILES | C=C(O)C1=CN(Cc2ccc(-c3ccccc3)cc2)c2cc(N3CCC(CNC)C3)c(F)cc2C1=C |
| InChI | InChI=1S/C31H32FN3O/c1-21-27-15-29(32)31(34-14-13-24(19-34)17-33-3)16-30(27)35(20-28(21)22(2)36)18-23-9-11-26(12-10-23)25-7-5-4-6-8-25/h4-12,15-16,20,24,33,36H,1-2,13-14,17-19H2,3H3 |
| InChIKey | QBFYPTKDPDBSAZ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|