C30H25FN4O — CID 134603899
1-[7-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)-6-fluoro-4-methylidene-1-[(4-phenylphenyl)methyl]quinolin-3-yl]ethenol (PubChem CID 134603899) has the molecular formula C30H25FN4O and a molecular weight of 476.56 g/mol. Its IUPAC name is 1-[7-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)-6-fluoro-4-methylidene-1-[(4-phenylphenyl)methyl]quinolin-3-yl]ethenol.
| Compound Name | 1-[7-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)-6-fluoro-4-methylidene-1-[(4-phenylphenyl)methyl]quinolin-3-yl]ethenol |
|---|---|
| PubChem CID | 134603899 |
| Molecular Formula | C30H25FN4O |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 1-[7-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)-6-fluoro-4-methylidene-1-[(4-phenylphenyl)methyl]quinolin-3-yl]ethenol |
| SMILES | C=C(O)C1=CN(Cc2ccc(-c3ccccc3)cc2)c2cc(N3Cc4cn[nH]c4C3)c(F)cc2C1=C |
| InChI | InChI=1S/C30H25FN4O/c1-19-25-12-27(31)30(35-16-24-14-32-33-28(24)18-35)13-29(25)34(17-26(19)20(2)36)15-21-8-10-23(11-9-21)22-6-4-3-5-7-22/h3-14,17,36H,1-2,15-16,18H2,(H,32,33) |
| InChIKey | AAGZRQSKAOEVER-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|