C18H28FN5O — CID 139960247
7-[3-(aminomethyl)piperidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-2,4-dihydroquinazolin-3-amine (PubChem CID 139960247) has the molecular formula C18H28FN5O and a molecular weight of 349.45 g/mol. Its IUPAC name is 7-[3-(aminomethyl)piperidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-2,4-dihydroquinazolin-3-amine.
| Compound Name | 7-[3-(aminomethyl)piperidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-2,4-dihydroquinazolin-3-amine |
|---|---|
| PubChem CID | 139960247 |
| Molecular Formula | C18H28FN5O |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 7-[3-(aminomethyl)piperidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-2,4-dihydroquinazolin-3-amine |
| SMILES | COc1c(N2CCCC(CN)C2)c(F)cc2c1N(C1CC1)CN(N)C2 |
| InChI | InChI=1S/C18H28FN5O/c1-25-18-16-13(10-23(21)11-24(16)14-4-5-14)7-15(19)17(18)22-6-2-3-12(8-20)9-22/h7,12,14H,2-6,8-11,20-21H2,1H3 |
| InChIKey | DJLHKBFAASBZGL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|