C18H26FN5 — CID 139960171
7-[1-(aminomethyl)-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclopropyl-6-fluoro-8-methyl-2,4-dihydroquinazolin-3-amine (PubChem CID 139960171) has the molecular formula C18H26FN5 and a molecular weight of 331.44 g/mol. Its IUPAC name is 7-[1-(aminomethyl)-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclopropyl-6-fluoro-8-methyl-2,4-dihydroquinazolin-3-amine.
| Compound Name | 7-[1-(aminomethyl)-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclopropyl-6-fluoro-8-methyl-2,4-dihydroquinazolin-3-amine |
|---|---|
| PubChem CID | 139960171 |
| Molecular Formula | C18H26FN5 |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | 7-[1-(aminomethyl)-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclopropyl-6-fluoro-8-methyl-2,4-dihydroquinazolin-3-amine |
| SMILES | Cc1c(N2CC3CC3(CN)C2)c(F)cc2c1N(C1CC1)CN(N)C2 |
| InChI | InChI=1S/C18H26FN5/c1-11-16-12(6-23(21)10-24(16)14-2-3-14)4-15(19)17(11)22-7-13-5-18(13,8-20)9-22/h4,13-14H,2-3,5-10,20-21H2,1H3 |
| InChIKey | ZSJZCZPYEOSGTD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 61.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|