C24H31F2N5O — CID 67012870
7-[(3R,4S)-3-[(1R)-1-amino-2-phenoxyethyl]-4-fluoropyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methyl-2,4-dihydroquinazolin-3-amine (PubChem CID 67012870) has the molecular formula C24H31F2N5O and a molecular weight of 443.54 g/mol. Its IUPAC name is 7-[(3R,4S)-3-[(1R)-1-amino-2-phenoxyethyl]-4-fluoropyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methyl-2,4-dihydroquinazolin-3-amine.
| Compound Name | 7-[(3R,4S)-3-[(1R)-1-amino-2-phenoxyethyl]-4-fluoropyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methyl-2,4-dihydroquinazolin-3-amine |
|---|---|
| PubChem CID | 67012870 |
| Molecular Formula | C24H31F2N5O |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 7-[(3R,4S)-3-[(1R)-1-amino-2-phenoxyethyl]-4-fluoropyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methyl-2,4-dihydroquinazolin-3-amine |
| SMILES | Cc1c(N2C[C@H]([C@@H](N)COc3ccccc3)[C@H](F)C2)c(F)cc2c1N(C1CC1)CN(N)C2 |
| InChI | InChI=1S/C24H31F2N5O/c1-15-23-16(10-30(28)14-31(23)17-7-8-17)9-20(25)24(15)29-11-19(21(26)12-29)22(27)13-32-18-5-3-2-4-6-18/h2-6,9,17,19,21-22H,7-8,10-14,27-28H2,1H3/t19-,21+,22-/m0/s1 |
| InChIKey | PIMLIIDODDXOPD-NNWRFLSQSA-N |
| XLogP | 2.93 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|